CAS 76666-32-5 appears in our catalog under these names: 3-Hydroxy-3'-methoxyflavone, 95%, 3'-Methoxyflavonol/ 99.84% (existing batch purity), 3'–Methoxyflavonol, 3-Hydroxy-3'-methoxyflavone, 98%, 98%, 3'-Methoxyflavonol (Standard). Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 25g, 5g, 50mg, 10mM (in 1ml dmso), 100mg, 250mg, Get quote.
3-hydroxy-2-(3-methoxyphenyl)chromen-4-one (CAS 76666-32-5) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 3-hydroxy-2-(3-methoxyphenyl)chromen-4-one. InChIKey: GYLGASXCHFNKHD-UHFFFAOYSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 3-hydroxy-2-(3-methoxyphenyl)chromen-4-one |
| InChIKey | GYLGASXCHFNKHD-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=C(C(=O)C3=CC=CC=C3O2)O |
Computed by PubChem (NCBI)