cas: 149777-84-4 — see every product listed under this CAS number, including other names
(E)-4,4,5,5-Tetramethyl-2-(4-Methylstyryl)-1,3,2-Dioxaborolane, 98%, 98% (CAS 149777-84-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112M10-100mg |
| cas | 149777-84-4 |
| size | 100mg |
| availability | 0.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-[(E)-2-(4-methylphenyl)ethenyl]-1,3,2-dioxaborolane (CAS 149777-84-4) is a chemical compound with the molecular formula C15H21BO2 and a molecular weight of 244.14 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(E)-2-(4-methylphenyl)ethenyl]-1,3,2-dioxaborolane. InChIKey: HHBWKASJNTZJLB-ZHACJKMWSA-N.
| Molecular formula | C15H21BO2 |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(E)-2-(4-methylphenyl)ethenyl]-1,3,2-dioxaborolane |
| InChIKey | HHBWKASJNTZJLB-ZHACJKMWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)