CAS 1219741-94-2 appears in our catalog under these names: 2-(4-Cyclopropylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(4-Cyclopropylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 4-(Cyclopropyl)phenylboronic acid pinacol ester, 95%, 4–Cyclopropylphenylboronic Acid Pinacol Ester, 4-Cyclopropylphenylboronic Acid Pinacol Ester 95%. Offered by: Biosynth, Fluorochem, Combi-blocks, GLPBio, Ambeed. Available pack sizes: 5g, 2g, 10g, 250mg, 1g, 100mg.
2-(4-cyclopropylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1219741-94-2) is a chemical compound with the molecular formula C15H21BO2 and a molecular weight of 244.14 g/mol. IUPAC name: 2-(4-cyclopropylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WYEYFTIWQILPTE-UHFFFAOYSA-N.
| Molecular formula | C15H21BO2 |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | 2-(4-cyclopropylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WYEYFTIWQILPTE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3CC3 |
Computed by PubChem (NCBI)