CAS 149777-84-4 appears in our catalog under these names: 4-Methyl-beta-styrylboronic acid pinacol ester, 98%, (E)–4,4,5,5–tetramethyl–2–(4–methylstyryl)–1,3,2–dioxaborolane, 4-Methyl-^b-styrylboronic acid pinacol ester, 98% , (E)-4,4,5,5-Tetramethyl-2-(4-methylstyryl)-1,3,2-dioxaborolane 98%, (E)-4,4,5,5-Tetramethyl-2-(4-Methylstyryl)-1,3,2-Dioxaborolane, 98%, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 500mg, 5g, 25g.
4,4,5,5-tetramethyl-2-[(E)-2-(4-methylphenyl)ethenyl]-1,3,2-dioxaborolane (CAS 149777-84-4) is a chemical compound with the molecular formula C15H21BO2 and a molecular weight of 244.14 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(E)-2-(4-methylphenyl)ethenyl]-1,3,2-dioxaborolane. InChIKey: HHBWKASJNTZJLB-ZHACJKMWSA-N.
| Molecular formula | C15H21BO2 |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(E)-2-(4-methylphenyl)ethenyl]-1,3,2-dioxaborolane |
| InChIKey | HHBWKASJNTZJLB-ZHACJKMWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)