Products 1187525-03-6
CAS 1187525-03-6 appears in our catalog under these names: 4，4，5，5–tetramethyl–2–(2–phenylprop–1–en–1–yl)–1，3，2–dioxaborolane, 4，4，5，5-tetramethyl-2-(2-phenylprop-1-en-1-yl)-1，3，2-dioxaborolane. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 500mg, 100mg.
4,4,5,5-tetramethyl-2-(2-phenylprop-1-enyl)-1,3,2-dioxaborolane (CAS 1187525-03-6) is a chemical compound with the molecular formula C15H21BO2 and a molecular weight of 244.14 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-phenylprop-1-enyl)-1,3,2-dioxaborolane. InChIKey: UWZANNWZLJPRSC-UHFFFAOYSA-N.
| Molecular formula | C15H21BO2 |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-phenylprop-1-enyl)-1,3,2-dioxaborolane |
| InChIKey | UWZANNWZLJPRSC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C=C(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)