CAS 445303-13-9 appears in our catalog under these names: 2,3-Dihydro-1H-inden-5-boronic acid, pinacol ester, 98%, 2-(2,3-Dihydro-1H-inden-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, 2-(2,3-Dihydro-1H-inden-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
2-(2,3-dihydro-1H-inden-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 445303-13-9) is a chemical compound with the molecular formula C15H21BO2 and a molecular weight of 244.14 g/mol. IUPAC name: 2-(2,3-dihydro-1H-inden-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: OTCOGJNOBVQVOH-UHFFFAOYSA-N.
| Molecular formula | C15H21BO2 |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | 2-(2,3-dihydro-1H-inden-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | OTCOGJNOBVQVOH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(CCC3)C=C2 |
Computed by PubChem (NCBI)