cas: 3717-19-9 — see every product listed under this CAS number, including other names
(E)-4-Nitrobenzaldehyde oxime, 85.0%, 85.0% (CAS 3717-19-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CTCW-5g |
| cas | 3717-19-9 |
| size | 5g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 179.60 Pln | |
| Chemat | 25g | 342.80 Pln |
| purity | 85.0% |
|---|---|
| delivery time | 3 weeks |
(NE)-N-[(4-nitrophenyl)methylidene]hydroxylamine (CAS 3717-19-9) is a chemical compound with the molecular formula C7H6N2O3 and a molecular weight of 166.13 g/mol. IUPAC name: (NE)-N-[(4-nitrophenyl)methylidene]hydroxylamine. InChIKey: WTLPAVBACRIHHC-VMPITWQZSA-N.
| Molecular formula | C7H6N2O3 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | (NE)-N-[(4-nitrophenyl)methylidene]hydroxylamine |
| InChIKey | WTLPAVBACRIHHC-VMPITWQZSA-N |
| SMILES | C1=CC(=CC=C1/C=N/O)[N+](=O)[O-] |
Computed by PubChem (NCBI)