CAS 102-38-5 appears in our catalog under these names: 3-Nitroformanilide, 95%, 3-Nitroformanilide, 3-Nitroformanilide, 97%, 97%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 5g, 100g, 25g, 500g, 1000g, 1g, 10g.
N-(3-nitrophenyl)formamide (CAS 102-38-5) is a chemical compound with the molecular formula C7H6N2O3 and a molecular weight of 166.13 g/mol. IUPAC name: N-(3-nitrophenyl)formamide. InChIKey: QCDUUALALDXTAD-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | N-(3-nitrophenyl)formamide |
| InChIKey | QCDUUALALDXTAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])NC=O |
Computed by PubChem (NCBI)