CAS 13120-39-3 appears in our catalog under these names: N-(2-Pyridyl)oxamic acid, 95%, Lornoxicam Impurity 7, N-(2-Pyridinyl)oxamic Acid, N-(2-Pyridyl)oxamic Acid, >95% (HPLC), N-(2-Pyridyl)oxamic acid. Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin, Mikromol, TRC. Available pack sizes: 100mg, 1g, 250mg, on request, 10mg, 25mg, 50mg, 200mg.
2-oxo-2-(pyridin-2-ylamino)acetic acid (CAS 13120-39-3) is a chemical compound with the molecular formula C7H6N2O3 and a molecular weight of 166.13 g/mol. IUPAC name: 2-oxo-2-(pyridin-2-ylamino)acetic acid. InChIKey: RQLBRIIHVJSCTG-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 2-oxo-2-(pyridin-2-ylamino)acetic acid |
| InChIKey | RQLBRIIHVJSCTG-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NC(=O)C(=O)O |
Computed by PubChem (NCBI)