Products 118543-96-7

CAS 118543-96-7 is the registry number for 5-Acetylpyrazine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

5-acetylpyrazine-2-carboxylic acid (CAS 118543-96-7) is a chemical compound with the molecular formula C7H6N2O3 and a molecular weight of 166.13 g/mol. IUPAC name: 5-acetylpyrazine-2-carboxylic acid. InChIKey: HMUCEWYEXBWAGY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6N2O3
Molecular weight166.13 g/mol
IUPAC name5-acetylpyrazine-2-carboxylic acid
InChIKeyHMUCEWYEXBWAGY-UHFFFAOYSA-N
SMILESCC(=O)C1=CN=C(C=N1)C(=O)O

Computed by PubChem (NCBI)