CAS 5832-38-2 is the registry number for 4-Methyl-5-nitropicolinaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-methyl-5-nitropyridine-2-carbaldehyde (CAS 5832-38-2) is a chemical compound with the molecular formula C7H6N2O3 and a molecular weight of 166.13 g/mol. IUPAC name: 4-methyl-5-nitropyridine-2-carbaldehyde. InChIKey: OBGLQHSGHQAMLV-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 4-methyl-5-nitropyridine-2-carbaldehyde |
| InChIKey | OBGLQHSGHQAMLV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)