cas: 96251-92-2 — see every product listed under this CAS number, including other names
(E)-Ethyl 3-(3-hydroxyphenyl)acrylate 95% (CAS 96251-92-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1517990-250mg |
| cas | 96251-92-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1716.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1517990 |
Ethyl (E)-3-(3-hydroxyphenyl)prop-2-enoate (CAS 96251-92-2) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: ethyl (E)-3-(3-hydroxyphenyl)prop-2-enoate. InChIKey: DOPAESGJVMAJIC-VOTSOKGWSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | ethyl (E)-3-(3-hydroxyphenyl)prop-2-enoate |
| InChIKey | DOPAESGJVMAJIC-VOTSOKGWSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC(=CC=C1)O |
Computed by PubChem (NCBI)