CAS 74248-66-1 appears in our catalog under these names: 4-(3-Oxobutyl)benzoic acid, 95%, 4-(3-oxobutyl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
4-(3-oxobutyl)benzoic acid (CAS 74248-66-1) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 4-(3-oxobutyl)benzoic acid. InChIKey: PJLBHTNCHZROBQ-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 4-(3-oxobutyl)benzoic acid |
| InChIKey | PJLBHTNCHZROBQ-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)