CAS 62956-62-1 appears in our catalog under these names: 6-Methoxy-2,3-dihydro-1h-indene-1-carboxylic acid, 95%, 6-methoxy-2,3-dihydro-1H-indene-1-carboxylic Acid, 6-Methoxy-2,3-dihydro-1H-indene-1-carboxylic acid 95%, 6-Methoxy-2,3-dihydro-1h-indene-1-carboxylic acid, 95%, 95%, 6-Methoxy-2,3-dihydro-1h-indene-1-carboxylic acid, 98%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25mg, 50mg, 0,5g.
6-methoxy-2,3-dihydro-1H-indene-1-carboxylic acid (CAS 62956-62-1) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 6-methoxy-2,3-dihydro-1H-indene-1-carboxylic acid. InChIKey: NYAXSJZIUOHLMW-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 6-methoxy-2,3-dihydro-1H-indene-1-carboxylic acid |
| InChIKey | NYAXSJZIUOHLMW-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CCC2C(=O)O)C=C1 |
Computed by PubChem (NCBI)