CAS 1260113-15-2 is the registry number for 3-Cyclobutoxy-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-cyclobutyloxybenzoic acid (CAS 1260113-15-2) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 3-cyclobutyloxybenzoic acid. InChIKey: LHXRYGWBPVPGFU-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 3-cyclobutyloxybenzoic acid |
| InChIKey | LHXRYGWBPVPGFU-UHFFFAOYSA-N |
| SMILES | C1CC(C1)OC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)