CAS 103986-76-1 appears in our catalog under these names: (2E)-3-(2-Methoxy-5-methylphenyl)acrylic acid, 95%, 3-(2-Methoxy-5-methylphenyl)acrylic acid, 97%, 3-(2-Methoxy-5-methylphenyl)acrylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-(2-methoxy-5-methylphenyl)prop-2-enoic acid (CAS 103986-76-1) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 3-(2-methoxy-5-methylphenyl)prop-2-enoic acid. InChIKey: JYHRDALEIAZLHY-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 3-(2-methoxy-5-methylphenyl)prop-2-enoic acid |
| InChIKey | JYHRDALEIAZLHY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC)C=CC(=O)O |
Computed by PubChem (NCBI)