Products 1611483-29-4
CAS 1611483-29-4 appears in our catalog under these names: (E)-GABAB receptor antagonist 1/ 95.26% (existing batch purity), (E)-GABAB receptor antagonist 1, ≥95%, ≥95%, CLH304a, 99.64%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
(E)-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxobut-3-enoic acid (CAS 1611483-29-4) is a chemical compound with the molecular formula C18H24O4 and a molecular weight of 304.4 g/mol. IUPAC name: (E)-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxobut-3-enoic acid. InChIKey: XIQDGAUDNMVMCD-BQYQJAHWSA-N.
| Molecular formula | C18H24O4 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | (E)-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxobut-3-enoic acid |
| InChIKey | XIQDGAUDNMVMCD-BQYQJAHWSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)/C=C/C(=O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
GABAB receptor antagonist 1, (E)-GABAB receptor antagonist 1, (E)-4-(3,5-Di-tert-butyl-4-hydroxyphenyl)-2-oxo-3-butenoic Acid, (E)-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxobut-3-enoic acid, compound 14 [PMID: 25050158], (3E)-4-(3,5-di-tert-butyl-4-hydroxyphenyl)-2-oxobut-3-enoic acid, (E)-4-(3,5-Di-tert-butyl-4-hydroxyphenyl)-2-oxobut-3-enoic acid, 4-(3,5-Di-tert-butyl-4-hydroxyphenyl)-2-oxobut-3-enoic acid, orb1709810, (E)-4-(3,5-ditert-butyl-4-hydroxy-phenyl)-2-oxo-but-3-enoic acid