cas: 836-41-9 — see every product listed under this CAS number, including other names
(E)-N-(4-Methoxybenzylidene)aniline, 98% (CAS 836-41-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F339977-10G |
| cas | 836-41-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 294.71 Pln | |
| Fluorochem | 25g | 393.63 Pln | |
| Fluorochem | 100g | 1424.52 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-methoxyphenyl)-N-phenylmethanimine (CAS 836-41-9) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: 1-(4-methoxyphenyl)-N-phenylmethanimine. InChIKey: MSWPGMRTURVKRJ-UHFFFAOYSA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-N-phenylmethanimine |
| InChIKey | MSWPGMRTURVKRJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C=NC2=CC=CC=C2 |
Computed by PubChem (NCBI)