CAS 868390-62-9 is the registry number for (3,4-Dimethylphenyl)(pyridin-4-yl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3,4-dimethylphenyl)-pyridin-4-ylmethanone (CAS 868390-62-9) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: (3,4-dimethylphenyl)-pyridin-4-ylmethanone. InChIKey: VSKRYFHKIGQHRM-UHFFFAOYSA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | (3,4-dimethylphenyl)-pyridin-4-ylmethanone |
| InChIKey | VSKRYFHKIGQHRM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C2=CC=NC=C2)C |
Computed by PubChem (NCBI)