CAS 4695-13-0 appears in our catalog under these names: 2,2-Diphenylacetamide, 95%, 2,2-Diphenylacetamide, 98% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 25g, 1g, 5g.
2,2-diphenylacetamide (CAS 4695-13-0) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: 2,2-diphenylacetamide. InChIKey: ZXQVXEAZKZFEEP-UHFFFAOYSA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 2,2-diphenylacetamide |
| InChIKey | ZXQVXEAZKZFEEP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)