CAS 836-44-2 appears in our catalog under these names: 4'-Amino-4-hydroxystilbene, 95%, 4'-Amino-4-hydroxystilbene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 2g, 1g, 250mg, 500mg, 1000mg, 2000mg, 5000mg.
4-[2-(4-aminophenyl)ethenyl]phenol (CAS 836-44-2) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: 4-[2-(4-aminophenyl)ethenyl]phenol. InChIKey: HGDVTCNLNRCTHW-UHFFFAOYSA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 4-[2-(4-aminophenyl)ethenyl]phenol |
| InChIKey | HGDVTCNLNRCTHW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=CC2=CC=C(C=C2)O)N |
Computed by PubChem (NCBI)