CAS 23302-83-2 appears in our catalog under these names: 1-Methyl-4-[(4-oxocyclohexadienylidene)ethylidene]-1,4-dihydropyridine, 95%, 4-(2-(1-Methylpyridin-4(1H)-ylidene)ethylidene)cyclohexa-2,5-dienone, 95%, 4–(2–(1–Methylpyridin–4(1H)–ylidene)ethylidene)cyclohexa–2,5–dienone, Brooker's merocyanine dye , Brooker's merocyanine dye. Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg, 25mg, 0,1g, 0,25g, 0,5g.
4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-dien-1-one (CAS 23302-83-2) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: 4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-dien-1-one. InChIKey: DBOHWMPKJCJANT-UHFFFAOYSA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-dien-1-one |
| InChIKey | DBOHWMPKJCJANT-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=CC=C2C=CC(=O)C=C2)C=C1 |
Computed by PubChem (NCBI)