cas: 538-51-2 — see every product listed under this CAS number, including other names
(E)-N-Benzylideneaniline, 97% (CAS 538-51-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F339976-250MG |
| cas | 538-51-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 25g | 268.67 Pln | |
| Fluorochem | 100g | 872.63 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
N,1-diphenylmethanimine (CAS 538-51-2) is a chemical compound with the molecular formula C13H11N and a molecular weight of 181.23 g/mol. IUPAC name: N,1-diphenylmethanimine. InChIKey: UVEWQKMPXAHFST-UHFFFAOYSA-N.
| Molecular formula | C13H11N |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | N,1-diphenylmethanimine |
| InChIKey | UVEWQKMPXAHFST-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=NC2=CC=CC=C2 |
Computed by PubChem (NCBI)