cas: 538-51-2 — see every product listed under this CAS number, including other names
Benzylideneaniline, >98.0%(GC)(T) (CAS 538-51-2) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B1034-25G |
| cas | 538-51-2 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 398.63 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
N,1-diphenylmethanimine (CAS 538-51-2) is a chemical compound with the molecular formula C13H11N and a molecular weight of 181.23 g/mol. IUPAC name: N,1-diphenylmethanimine. InChIKey: UVEWQKMPXAHFST-UHFFFAOYSA-N.
| Molecular formula | C13H11N |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | N,1-diphenylmethanimine |
| InChIKey | UVEWQKMPXAHFST-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=NC2=CC=CC=C2 |
Computed by PubChem (NCBI)