N-Benzylideneaniline 98%
cas: 538-51-2 — see every product listed under this CAS number, including other names
N-Benzylideneaniline 98% (CAS 538-51-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1359752-5g |
| cas | 538-51-2 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 186.81 Pln | |
| Ambeed | 25g | 392.62 Pln | |
| Ambeed | 100g | 1282.62 Pln | |
| Ambeed | 500g | 5109.62 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1359752 |
N,1-diphenylmethanimine (CAS 538-51-2) is a chemical compound with the molecular formula C13H11N and a molecular weight of 181.23 g/mol. IUPAC name: N,1-diphenylmethanimine. InChIKey: UVEWQKMPXAHFST-UHFFFAOYSA-N.
| Molecular formula | C13H11N |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | N,1-diphenylmethanimine |
| InChIKey | UVEWQKMPXAHFST-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=NC2=CC=CC=C2 |
Computed by PubChem (NCBI)