cas: 538-51-2 — see every product listed under this CAS number, including other names
N-Benzylideneaniline, 99.97% (CAS 538-51-2) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 5 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W025799-10 g |
| cas | 538-51-2 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 310.40 Pln | |
| MedChemExpress | 5 g | 240.74 Pln | |
| MedChemExpress | 25 g | 477.59 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.97% |
N,1-diphenylmethanimine (CAS 538-51-2) is a chemical compound with the molecular formula C13H11N and a molecular weight of 181.23 g/mol. IUPAC name: N,1-diphenylmethanimine. InChIKey: UVEWQKMPXAHFST-UHFFFAOYSA-N.
| Molecular formula | C13H11N |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | N,1-diphenylmethanimine |
| InChIKey | UVEWQKMPXAHFST-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=NC2=CC=CC=C2 |
Computed by PubChem (NCBI)