cas: 117292-80-5 — see every product listed under this CAS number, including other names
(E)-phenethyl 3-(3-hydroxy-4-methoxyphenyl)acrylate, ≥98%, ≥98% (CAS 117292-80-5) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111E3B-10mg |
| cas | 117292-80-5 |
| size | 10mg |
| availability | 2.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 299.60 Pln | |
| Chemat | 50mg | 741.20 Pln | |
| Chemat | 250mg | 2339.60 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
2-phenylethyl (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate (CAS 117292-80-5) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: 2-phenylethyl (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate. InChIKey: LDEGDBUJVGNJEU-CSKARUKUSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | 2-phenylethyl (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
| InChIKey | LDEGDBUJVGNJEU-CSKARUKUSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)OCCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)