CAS 47230-38-6 appears in our catalog under these names: Diethyl biphenyl-4,4'-dicarboxylate, 98%, Diethyl 4,4'–Biphenyldicarboxylate, Diethyl 4,4'-Biphenyldicarboxylate, Diethyl 4,4'-Biphenyldicarboxylate, >98.0%(GC)(T), Diethyl [1,1'-biphenyl]-4,4'-dicarboxylate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 1g, 5g, 200mg, 2g, 10g, 250mg.
Ethyl 4-(4-ethoxycarbonylphenyl)benzoate (CAS 47230-38-6) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: ethyl 4-(4-ethoxycarbonylphenyl)benzoate. InChIKey: SYTZNHBXNLYWAK-UHFFFAOYSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | ethyl 4-(4-ethoxycarbonylphenyl)benzoate |
| InChIKey | SYTZNHBXNLYWAK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)OCC |
Computed by PubChem (NCBI)