CAS 18493-34-0 appears in our catalog under these names: 2,4,4'-Trimethoxychalcone, 95%, 2,4,4'-Trimethoxychalcone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 50g, 1000g.
(E)-3-(2,4-dimethoxyphenyl)-1-(4-methoxyphenyl)prop-2-en-1-one (CAS 18493-34-0) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: (E)-3-(2,4-dimethoxyphenyl)-1-(4-methoxyphenyl)prop-2-en-1-one. InChIKey: QASJJCFLWLUQLE-YRNVUSSQSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | (E)-3-(2,4-dimethoxyphenyl)-1-(4-methoxyphenyl)prop-2-en-1-one |
| InChIKey | QASJJCFLWLUQLE-YRNVUSSQSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)/C=C/C2=C(C=C(C=C2)OC)OC |
Computed by PubChem (NCBI)