CAS 935478-29-8 appears in our catalog under these names: 3'-(tert-Butyl)-5'-formyl-4'-hydroxybiphenyl-4-carboxylic acid, 95%, 3'-(tert-Butyl)-5'-formyl-4'-hydroxybiphenyl-4-carboxylic Acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
4-(3-tert-butyl-5-formyl-4-hydroxyphenyl)benzoic acid (CAS 935478-29-8) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: 4-(3-tert-butyl-5-formyl-4-hydroxyphenyl)benzoic acid. InChIKey: WRHFIAQZSCZHQK-UHFFFAOYSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | 4-(3-tert-butyl-5-formyl-4-hydroxyphenyl)benzoic acid |
| InChIKey | WRHFIAQZSCZHQK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)