Products 3195-37-7
CAS 3195-37-7 appears in our catalog under these names: Methyl 2-(2-(benzyloxy)phenyl)-3-methoxyacrylate, 95%, Diphenyl adipate, 97%, Hexanedioic acid，1，6–diphenyl ester, Diphenyl adipate, 95%, 95%, DIPHENYL ADIPATE, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
Diphenyl hexanedioate (CAS 3195-37-7) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: diphenyl hexanedioate. InChIKey: BDIFKMOUQSYRRD-UHFFFAOYSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | diphenyl hexanedioate |
| InChIKey | BDIFKMOUQSYRRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)CCCCC(=O)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)