CAS 24243-40-1 appears in our catalog under these names: (E/Z)–Methyl mycophenolate, (E/Z)-Methyl mycophenolate. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, Get quote.
Methyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate (CAS 24243-40-1) is a chemical compound with the molecular formula C18H22O6 and a molecular weight of 334.4 g/mol. IUPAC name: methyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate. InChIKey: ZPXRQFLATDNYSS-BJMVGYQFSA-N.
| Molecular formula | C18H22O6 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | methyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate |
| InChIKey | ZPXRQFLATDNYSS-BJMVGYQFSA-N |
| SMILES | CC1=C2COC(=O)C2=C(C(=C1OC)C/C=C(\C)/CCC(=O)OC)O |
Computed by PubChem (NCBI)