cas: 3906-16-9 — see every product listed under this CAS number, including other names
(R)-(+)-1-(2-Naphthyl)ethylamine, 98%, 98% (CAS 3906-16-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114C5B-1g |
| cas | 3906-16-9 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 246.80 Pln | |
| Chemat | 25g | 438.80 Pln | |
| Chemat | 100g | 1576.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1R)-1-naphthalen-2-ylethanamine (CAS 3906-16-9) is a chemical compound with the molecular formula C12H13N and a molecular weight of 171.24 g/mol. IUPAC name: (1R)-1-naphthalen-2-ylethanamine. InChIKey: KHSYYLCXQKCYQX-SECBINFHSA-N.
| Molecular formula | C12H13N |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | (1R)-1-naphthalen-2-ylethanamine |
| InChIKey | KHSYYLCXQKCYQX-SECBINFHSA-N |
| SMILES | C[C@H](C1=CC2=CC=CC=C2C=C1)N |
Computed by PubChem (NCBI)