cas: 683276-64-4 — see every product listed under this CAS number, including other names
(R)-(2-Methyloxiran-2-yl)methyl 4-nitrobenzenesulfonate 97% (CAS 683276-64-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1142380-50mg |
| cas | 683276-64-4 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 587.31 Pln | |
| Ambeed | 100mg | 948.88 Pln | |
| Ambeed | 250mg | 1827.75 Pln | |
| Ambeed | 1g | 5343.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1142380 |
[(2R)-2-methyloxiran-2-yl]methyl 4-nitrobenzenesulfonate (CAS 683276-64-4) is a chemical compound with the molecular formula C10H11NO6S and a molecular weight of 273.26 g/mol. IUPAC name: [(2R)-2-methyloxiran-2-yl]methyl 4-nitrobenzenesulfonate. InChIKey: NXRMOVSGORLBCA-SNVBAGLBSA-N.
| Molecular formula | C10H11NO6S |
|---|---|
| Molecular weight | 273.26 g/mol |
| IUPAC name | [(2R)-2-methyloxiran-2-yl]methyl 4-nitrobenzenesulfonate |
| InChIKey | NXRMOVSGORLBCA-SNVBAGLBSA-N |
| SMILES | C[C@@]1(CO1)COS(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)