CAS 2113708-53-3 is the registry number for Empagliflozin Impurity 136. Offered by: Chemat Brand. Available pack sizes: on request.
[(3R)-oxolan-3-yl] 4-nitrobenzenesulfonate (CAS 2113708-53-3) is a chemical compound with the molecular formula C10H11NO6S and a molecular weight of 273.26 g/mol. IUPAC name: [(3R)-oxolan-3-yl] 4-nitrobenzenesulfonate. InChIKey: SZWICZZQOYMFKG-SECBINFHSA-N.
| Molecular formula | C10H11NO6S |
|---|---|
| Molecular weight | 273.26 g/mol |
| IUPAC name | [(3R)-oxolan-3-yl] 4-nitrobenzenesulfonate |
| InChIKey | SZWICZZQOYMFKG-SECBINFHSA-N |
| SMILES | C1COC[C@@H]1OS(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)