CAS 714203-17-5 is the registry number for N-1,3-Benzodioxol-5-yl-n-(methylsulfonyl)glycine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]acetic acid (CAS 714203-17-5) is a chemical compound with the molecular formula C10H11NO6S and a molecular weight of 273.26 g/mol. IUPAC name: 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]acetic acid. InChIKey: MXGFMPSVDSCLME-UHFFFAOYSA-N.
| Molecular formula | C10H11NO6S |
|---|---|
| Molecular weight | 273.26 g/mol |
| IUPAC name | 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]acetic acid |
| InChIKey | MXGFMPSVDSCLME-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N(CC(=O)O)C1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)