CAS 683276-63-3 appears in our catalog under these names: Delamanid Impurity 8, (S)-(2-Methyloxiran-2-yl)methyl 4-nitrobenzenesulfonate, 98%+(GC-MS),RG, 98%+(GC-MS),RG. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 250mg, 1g, 5g, 25g.
[(2S)-2-methyloxiran-2-yl]methyl 4-nitrobenzenesulfonate (CAS 683276-63-3) is a chemical compound with the molecular formula C10H11NO6S and a molecular weight of 273.26 g/mol. IUPAC name: [(2S)-2-methyloxiran-2-yl]methyl 4-nitrobenzenesulfonate. InChIKey: NXRMOVSGORLBCA-JTQLQIEISA-N.
| Molecular formula | C10H11NO6S |
|---|---|
| Molecular weight | 273.26 g/mol |
| IUPAC name | [(2S)-2-methyloxiran-2-yl]methyl 4-nitrobenzenesulfonate |
| InChIKey | NXRMOVSGORLBCA-JTQLQIEISA-N |
| SMILES | C[C@]1(CO1)COS(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)