Products 1403483-55-5

CAS 1403483-55-5 is the registry number for 2-Methyl-2-[(2-nitrobenzene)sulfonyl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-methyl-2-(2-nitrophenyl)sulfonylpropanoic acid (CAS 1403483-55-5) is a chemical compound with the molecular formula C10H11NO6S and a molecular weight of 273.26 g/mol. IUPAC name: 2-methyl-2-(2-nitrophenyl)sulfonylpropanoic acid. InChIKey: NAEVYVZCUKBQKR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO6S
Molecular weight273.26 g/mol
IUPAC name2-methyl-2-(2-nitrophenyl)sulfonylpropanoic acid
InChIKeyNAEVYVZCUKBQKR-UHFFFAOYSA-N
SMILESCC(C)(C(=O)O)S(=O)(=O)C1=CC=CC=C1[N+](=O)[O-]

Computed by PubChem (NCBI)