cas: 215178-46-4 — see every product listed under this CAS number, including other names
(R)-(9H-Fluoren-9-yl)methyl (1-hydroxy-3-methylbutan-2-yl)carbamate, 97% (CAS 215178-46-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F053753-100MG |
| cas | 215178-46-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 96.86 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 341.56 Pln | |
| Fluorochem | 25g | 950.72 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
9H-fluoren-9-ylmethyl N-[(2R)-1-hydroxy-3-methylbutan-2-yl]carbamate (CAS 215178-46-4) is a chemical compound with the molecular formula C20H23NO3 and a molecular weight of 325.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2R)-1-hydroxy-3-methylbutan-2-yl]carbamate. InChIKey: MYMGENAMKAPEMT-IBGZPJMESA-N.
| Molecular formula | C20H23NO3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2R)-1-hydroxy-3-methylbutan-2-yl]carbamate |
| InChIKey | MYMGENAMKAPEMT-IBGZPJMESA-N |
| SMILES | CC(C)[C@H](CO)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)