cas: 151004-93-2 — see every product listed under this CAS number, including other names
(R)-1,2,3,4-Tetrahydroisoquinoline-1-carboxylic acid, 95% (CAS 151004-93-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F091817-100MG |
| cas | 151004-93-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 357.18 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(1R)-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid (CAS 151004-93-2) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: (1R)-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid. InChIKey: OXFGRWIKQDSSLY-SECBINFHSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | (1R)-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid |
| InChIKey | OXFGRWIKQDSSLY-SECBINFHSA-N |
| SMILES | C1CN[C@H](C2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)