Products 27508-85-6
CAS 27508-85-6 appears in our catalog under these names: 5,7-Dimethoxy-1H-indole, 98%, 5,7-Dimethoxy-1H-indole, 97%, 5,7-Dimethoxyindole, 5,7-Dimethoxy-1H-indole, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 0,1g, 0,05g, 0,25g.
5,7-dimethoxy-1H-indole (CAS 27508-85-6) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 5,7-dimethoxy-1H-indole. InChIKey: ACIZYTYDGVHTIZ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 5,7-dimethoxy-1H-indole |
| InChIKey | ACIZYTYDGVHTIZ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)C=CN2)OC |
Computed by PubChem (NCBI)
Synonyms:
5,7-dimethoxy-1H-indole, 1H-Indole, 5,7-dimethoxy-