cas: 151004-93-2 — see every product listed under this CAS number, including other names
(R)-1,2,3,4-Tetrahydroisoquinoline-1-carboxylic acid, 98%, 98% (CAS 151004-93-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112N1A-100mg |
| cas | 151004-93-2 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 500mg | 434.00 Pln | |
| Chemat | 1g | 770.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1R)-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid (CAS 151004-93-2) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: (1R)-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid. InChIKey: OXFGRWIKQDSSLY-SECBINFHSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | (1R)-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid |
| InChIKey | OXFGRWIKQDSSLY-SECBINFHSA-N |
| SMILES | C1CN[C@H](C2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)