CAS 141410-06-2 appears in our catalog under these names: Methyl (S)–indoline–2–carboxylate, (S)-(+)-Methyl indoline-2-carboxylate, (S)-(+)-Methyl indoline-2-carboxylate, 95%, Methyl (S)-indoline-2-carboxylate, 97%, (S)-(+)-Methyl indoline-2-carboxylate, 98%. Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 2,5g, 25g, 10g, 100g, 250mg.
Methyl (2S)-2,3-dihydro-1H-indole-2-carboxylate (CAS 141410-06-2) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: methyl (2S)-2,3-dihydro-1H-indole-2-carboxylate. InChIKey: URORFKDEPJFPOV-VIFPVBQESA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | methyl (2S)-2,3-dihydro-1H-indole-2-carboxylate |
| InChIKey | URORFKDEPJFPOV-VIFPVBQESA-N |
| SMILES | COC(=O)[C@@H]1CC2=CC=CC=C2N1 |
Computed by PubChem (NCBI)