CAS 293737-30-1 appears in our catalog under these names: Methyl (2R)-2,3-dihydro-1H-indole-2-carboxylate, 95%, (R)-Methyl indoline-2-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.
Methyl (2R)-2,3-dihydro-1H-indole-2-carboxylate (CAS 293737-30-1) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: methyl (2R)-2,3-dihydro-1H-indole-2-carboxylate. InChIKey: URORFKDEPJFPOV-SECBINFHSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | methyl (2R)-2,3-dihydro-1H-indole-2-carboxylate |
| InChIKey | URORFKDEPJFPOV-SECBINFHSA-N |
| SMILES | COC(=O)[C@H]1CC2=CC=CC=C2N1 |
Computed by PubChem (NCBI)