cas: 791098-81-2 — see every product listed under this CAS number, including other names
(R)-1-(2,4-Difluorophenyl)ethanamine hydrochloride, 97% (CAS 791098-81-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F223761-250MG |
| cas | 791098-81-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 544.62 Pln | |
| Fluorochem | 5g | 2215.90 Pln | |
| Fluorochem | 10g | 4220.41 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1R)-1-(2,4-difluorophenyl)ethanamine;hydrochloride (CAS 791098-81-2) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: (1R)-1-(2,4-difluorophenyl)ethanamine;hydrochloride. InChIKey: BWIGKZOWBCNPTI-NUBCRITNSA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | (1R)-1-(2,4-difluorophenyl)ethanamine;hydrochloride |
| InChIKey | BWIGKZOWBCNPTI-NUBCRITNSA-N |
| SMILES | C[C@H](C1=C(C=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)