CAS 441074-81-3 appears in our catalog under these names: (R)-1-(3,4-Difluorophenyl)ethanamine hydrochloride, 95%, (R)–1–(3,4–Difluorophenyl)ethanamine hydrochloride, (R)-1-(3,4-Difluorophenyl)ethanamine hydrochloride, 95%, 95%, (R)-1-(3,4-Difluorophenyl)ethanamine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(1R)-1-(3,4-difluorophenyl)ethanamine;hydrochloride (CAS 441074-81-3) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: (1R)-1-(3,4-difluorophenyl)ethanamine;hydrochloride. InChIKey: KRYCUFKROCITGA-NUBCRITNSA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | (1R)-1-(3,4-difluorophenyl)ethanamine;hydrochloride |
| InChIKey | KRYCUFKROCITGA-NUBCRITNSA-N |
| SMILES | C[C@H](C1=CC(=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)