CAS 17291-91-7 is the registry number for 2-(2,6-Difluorophenyl)ethan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-(2,6-difluorophenyl)ethanamine;hydrochloride (CAS 17291-91-7) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: 2-(2,6-difluorophenyl)ethanamine;hydrochloride. InChIKey: ITOYJPKYBAWEGK-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)ethanamine;hydrochloride |
| InChIKey | ITOYJPKYBAWEGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CCN)F.Cl |
Computed by PubChem (NCBI)