CAS 1391449-47-0 appears in our catalog under these names: (R)-1-(2,5-Difluorophenyl)ethanamine hydrochloride, 95%, (R)–1–(2,5–Difluorophenyl)ethanamine hydrochloride, (R)-1-(2,5-Difluorophenyl)ethanamine hydrochloride ee, (R)-1-(2,5-Difluorophenyl)ethanamine hydrochloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 100mg, 250mg.
(1R)-1-(2,5-difluorophenyl)ethanamine;hydrochloride (CAS 1391449-47-0) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: (1R)-1-(2,5-difluorophenyl)ethanamine;hydrochloride. InChIKey: NQFUIZOIKVFLIM-NUBCRITNSA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | (1R)-1-(2,5-difluorophenyl)ethanamine;hydrochloride |
| InChIKey | NQFUIZOIKVFLIM-NUBCRITNSA-N |
| SMILES | C[C@H](C1=C(C=CC(=C1)F)F)N.Cl |
Computed by PubChem (NCBI)