CAS 276875-47-9 appears in our catalog under these names: 1-(2,4-Difluorophenyl)ethylamine hydrochloride, 95%, 1-(2,4-Difluorophenyl)ethanamine hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1-(2,4-difluorophenyl)ethanamine;hydrochloride (CAS 276875-47-9) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: 1-(2,4-difluorophenyl)ethanamine;hydrochloride. InChIKey: BWIGKZOWBCNPTI-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)ethanamine;hydrochloride |
| InChIKey | BWIGKZOWBCNPTI-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)