(R)-1-(2-Bromophenyl)ethanamine hydrochloride, 97%
cas: 1187931-17-4 — see every product listed under this CAS number, including other names
(R)-1-(2-Bromophenyl)ethanamine hydrochloride, 97% (CAS 1187931-17-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A234196-250mg |
| cas | 1187931-17-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 676.31 Pln | |
| Ambeed | 25g | 3084.88 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 789.20 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 236.61 Pln | |
| BLDpharm | 5g | 725.32 Pln | |
| BLDpharm | 25g | 3324.41 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(1R)-1-(2-bromophenyl)ethanamine;hydrochloride (CAS 1187931-17-4) is a chemical compound with the molecular formula C8H11BrClN and a molecular weight of 236.53 g/mol. IUPAC name: (1R)-1-(2-bromophenyl)ethanamine;hydrochloride. InChIKey: MPTGUFFHOKLEFK-FYZOBXCZSA-N.
| Molecular formula | C8H11BrClN |
|---|---|
| Molecular weight | 236.53 g/mol |
| IUPAC name | (1R)-1-(2-bromophenyl)ethanamine;hydrochloride |
| InChIKey | MPTGUFFHOKLEFK-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC=CC=C1Br)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(1R)-1-(2-bromophenyl)ethan-1-amine hydrochloride, (R)-1-(2-Bromophenyl)ethanamine hydrochloride, (1R)-1-(2-bromophenyl)ethanamine;hydrochloride, (R)-1-(2-Bromo-phenyl)-ethylamine hydrochloride, (R)-1-(2-bromophenyl)ethan-1-amine hydrochloride, BenzeneMethanaMine, 2-broMo-a-Methyl-, hydrochloride, (R)-, (R)-1-(2-Bromophenyl)ethanamine HCl, (1R)-1-(2-Dromophenyl)ethan-1-amine hydrochloride